C28H17N2O2PS — CID 118220105
2-(17-pyridin-2-yl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-5-yl)pyridine (PubChem CID 118220105) has the molecular formula C28H17N2O2PS and a molecular weight of 476.50 g/mol. Its IUPAC name is 2-(17-pyridin-2-yl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-5-yl)pyridine.
| Compound Name | 2-(17-pyridin-2-yl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-5-yl)pyridine |
|---|---|
| PubChem CID | 118220105 |
| Molecular Formula | C28H17N2O2PS |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 2-(17-pyridin-2-yl-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-5-yl)pyridine |
| SMILES | S=P12c3ccc(-c4ccccn4)cc3Oc3cccc(c31)Oc1cc(-c3ccccn3)ccc12 |
| InChI | InChI=1S/C28H17N2O2PS/c34-33-26-12-10-18(20-6-1-3-14-29-20)16-24(26)31-22-8-5-9-23(28(22)33)32-25-17-19(11-13-27(25)33)21-7-2-4-15-30-21/h1-17H |
| InChIKey | JZLPFQCTFNOJMW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|