C30H21N2O3P — CID 118219917
5,17-bis(2-methyl-4-pyridinyl)-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene 1-oxide (PubChem CID 118219917) has the molecular formula C30H21N2O3P and a molecular weight of 488.48 g/mol. Its IUPAC name is 5,17-bis(2-methyl-4-pyridinyl)-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene 1-oxide.
| Compound Name | 5,17-bis(2-methyl-4-pyridinyl)-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene 1-oxide |
|---|---|
| PubChem CID | 118219917 |
| Molecular Formula | C30H21N2O3P |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 5,17-bis(2-methyl-4-pyridinyl)-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaene 1-oxide |
| SMILES | Cc1cc(-c2ccc3c(c2)Oc2cccc4c2P3(=O)c2ccc(-c3ccnc(C)c3)cc2O4)ccn1 |
| InChI | InChI=1S/C30H21N2O3P/c1-18-14-22(10-12-31-18)20-6-8-28-26(16-20)34-24-4-3-5-25-30(24)36(28,33)29-9-7-21(17-27(29)35-25)23-11-13-32-19(2)15-23/h3-17H,1-2H3 |
| InChIKey | PVJMPDJGRQYXSG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|