C31H26N3O2PtS2- — CID 58401801
1-[2-[2,4-bis(phenylsulfanyl)benzene-6-id-1-yl]-4-pyridinyl]-N-methylmethanamine;platinum;pyridine-2-carboxylic acid (PubChem CID 58401801) has the molecular formula C31H26N3O2PtS2- and a molecular weight of 731.78 g/mol. Its IUPAC name is 1-[2-[2,4-bis(phenylsulfanyl)benzene-6-id-1-yl]-4-pyridinyl]-N-methylmethanamine;platinum;pyridine-2-carboxylic acid.
| Compound Name | 1-[2-[2,4-bis(phenylsulfanyl)benzene-6-id-1-yl]-4-pyridinyl]-N-methylmethanamine;platinum;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 58401801 |
| Molecular Formula | C31H26N3O2PtS2- |
| Molecular Weight | 731.78 g/mol |
| Exact Mass | 731.11 |
| IUPAC Name | 1-[2-[2,4-bis(phenylsulfanyl)benzene-6-id-1-yl]-4-pyridinyl]-N-methylmethanamine;platinum;pyridine-2-carboxylic acid |
| SMILES | CNCc1ccnc(-c2[c-]cc(Sc3ccccc3)cc2Sc2ccccc2)c1.O=C(O)c1ccccn1.[Pt] |
| InChI | InChI=1S/C25H21N2S2.C6H5NO2.Pt/c1-26-18-19-14-15-27-24(16-19)23-13-12-22(28-20-8-4-2-5-9-20)17-25(23)29-21-10-6-3-7-11-21;8-6(9)5-3-1-2-4-7-5;/h2-12,14-17,26H,18H2,1H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | HYDRFDWZZKUWAL-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.78 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|