C34H26IrN3O2- — CID 59459719
7-carbazol-9-yl-5-phenyl-9H-pyrido[3,2-b]indol-9-ide;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 59459719) has the molecular formula C34H26IrN3O2- and a molecular weight of 700.82 g/mol. Its IUPAC name is 7-carbazol-9-yl-5-phenyl-9H-pyrido[3,2-b]indol-9-ide;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 7-carbazol-9-yl-5-phenyl-9H-pyrido[3,2-b]indol-9-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 59459719 |
| Molecular Formula | C34H26IrN3O2- |
| Molecular Weight | 700.82 g/mol |
| Exact Mass | 701.17 |
| IUPAC Name | 7-carbazol-9-yl-5-phenyl-9H-pyrido[3,2-b]indol-9-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.[Ir].[c-]1cc(-n2c3ccccc3c3ccccc32)cc2c1c1ncccc1n2-c1ccccc1 |
| InChI | InChI=1S/C29H18N3.C5H8O2.Ir/c1-2-9-20(10-3-1)31-27-15-8-18-30-29(27)24-17-16-21(19-28(24)31)32-25-13-6-4-11-22(25)23-12-5-7-14-26(23)32;1-4(6)3-5(2)7;/h1-16,18-19H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | MOFYFFGAOOEAHD-LWFKIUJUSA-N |
| XLogP | 8.11 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.82 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|