C70H46N4Pt — CID 59459810
bis(7-(3,5-diphenylphenyl)-5-phenyl-9H-pyrido[3,2-b]indol-9-ide);platinum(2+) (PubChem CID 59459810) has the molecular formula C70H46N4Pt and a molecular weight of 1138.24 g/mol. Its IUPAC name is bis(7-(3,5-diphenylphenyl)-5-phenyl-9H-pyrido[3,2-b]indol-9-ide);platinum(2+).
| Compound Name | bis(7-(3,5-diphenylphenyl)-5-phenyl-9H-pyrido[3,2-b]indol-9-ide);platinum(2+) |
|---|---|
| PubChem CID | 59459810 |
| Molecular Formula | C70H46N4Pt |
| Molecular Weight | 1138.24 g/mol |
| Exact Mass | 1137.34 |
| IUPAC Name | bis(7-(3,5-diphenylphenyl)-5-phenyl-9H-pyrido[3,2-b]indol-9-ide);platinum(2+) |
| SMILES | [Pt+2].[c-]1cc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)cc2c1c1ncccc1n2-c1ccccc1.[c-]1cc(-c2cc(-c3ccccc3)cc(-c3ccccc3)c2)cc2c1c1ncccc1n2-c1ccccc1 |
| InChI | InChI=1S/2C35H23N2.Pt/c2*1-4-11-25(12-5-1)28-21-29(26-13-6-2-7-14-26)23-30(22-28)27-18-19-32-34(24-27)37(31-15-8-3-9-16-31)33-17-10-20-36-35(32)33;/h2*1-18,20-24H;/q2*-1;+2 |
| InChIKey | FLCXKLQRHVMAOV-UHFFFAOYSA-N |
| XLogP | 17.96 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1138.24 |
| LogP ≤ 5 | 17.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|