C26H37N2O5Pt- — CID 58401694
(Z)-4-ethyl-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;[2-[2-(hydroxymethyl)-6-methoxy-4H-pyridin-4-id-3-yl]-4-pyridinyl]methanol;platinum (PubChem CID 58401694) has the molecular formula C26H37N2O5Pt- and a molecular weight of 652.67 g/mol. Its IUPAC name is (Z)-4-ethyl-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;[2-[2-(hydroxymethyl)-6-methoxy-4H-pyridin-4-id-3-yl]-4-pyridinyl]methanol;platinum.
| Compound Name | (Z)-4-ethyl-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;[2-[2-(hydroxymethyl)-6-methoxy-4H-pyridin-4-id-3-yl]-4-pyridinyl]methanol;platinum |
|---|---|
| PubChem CID | 58401694 |
| Molecular Formula | C26H37N2O5Pt- |
| Molecular Weight | 652.67 g/mol |
| Exact Mass | 652.24 |
| IUPAC Name | (Z)-4-ethyl-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one;[2-[2-(hydroxymethyl)-6-methoxy-4H-pyridin-4-id-3-yl]-4-pyridinyl]methanol;platinum |
| SMILES | CC/C(C(=O)C(C)(C)C)=C(/O)C(C)(C)C.COc1c[c-]c(-c2cc(CO)ccn2)c(CO)n1.[Pt] |
| InChI | InChI=1S/C13H13N2O3.C13H24O2.Pt/c1-18-13-3-2-10(12(8-17)15-13)11-6-9(7-16)4-5-14-11;1-8-9(10(14)12(2,3)4)11(15)13(5,6)7;/h3-6,16-17H,7-8H2,1H3;14H,8H2,1-7H3;/q-1;;/b;10-9-; |
| InChIKey | IKJVUYFUPJVJBY-MEILSSRFSA-N |
| XLogP | 4.80 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.67 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|