C36H48N4O4Pt2-2 — CID 177296338
3,6-dipyridin-2-yl-2,5-dihydropyrazine-2,5-diide;bis((Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one);platinum (PubChem CID 177296338) has the molecular formula C36H48N4O4Pt2-2 and a molecular weight of 990.96 g/mol. Its IUPAC name is 3,6-dipyridin-2-yl-2,5-dihydropyrazine-2,5-diide;bis((Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one);platinum.
| Compound Name | 3,6-dipyridin-2-yl-2,5-dihydropyrazine-2,5-diide;bis((Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one);platinum |
|---|---|
| PubChem CID | 177296338 |
| Molecular Formula | C36H48N4O4Pt2-2 |
| Molecular Weight | 990.96 g/mol |
| Exact Mass | 990.30 |
| IUPAC Name | 3,6-dipyridin-2-yl-2,5-dihydropyrazine-2,5-diide;bis((Z)-5-hydroxy-2,2,6,6-tetramethylhept-4-en-3-one);platinum |
| SMILES | CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.CC(C)(C)C(=O)/C=C(\O)C(C)(C)C.[Pt].[Pt].[c-]1nc(-c2ccccn2)[c-]nc1-c1ccccn1 |
| InChI | InChI=1S/C14H8N4.2C11H20O2.2Pt/c1-3-7-15-11(5-1)13-9-18-14(10-17-13)12-6-2-4-8-16-12;2*1-10(2,3)8(12)7-9(13)11(4,5)6;;/h1-8H;2*7,12H,1-6H3;;/q-2;;;;/b;2*8-7-;; |
| InChIKey | NLAGOHUANKWLMD-OXJOZFAVSA-N |
| XLogP | 8.38 |
| TPSA | 126.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.96 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|