C12H16N2O — CID 818325
(E)-1-amino-4,4-dimethyl-1-pyridin-2-ylpent-1-en-3-one (PubChem CID 818325) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (E)-1-amino-4,4-dimethyl-1-pyridin-2-ylpent-1-en-3-one.
| Compound Name | (E)-1-amino-4,4-dimethyl-1-pyridin-2-ylpent-1-en-3-one |
|---|---|
| PubChem CID | 818325 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (E)-1-amino-4,4-dimethyl-1-pyridin-2-ylpent-1-en-3-one |
| SMILES | CC(C)(C)C(=O)/C=C(/N)c1ccccn1 |
| InChI | InChI=1S/C12H16N2O/c1-12(2,3)11(15)8-9(13)10-6-4-5-7-14-10/h4-8H,13H2,1-3H3/b9-8+ |
| InChIKey | OLTRVMIVQDZHCG-CMDGGOBGSA-N |
| XLogP | 2.00 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|