C8H11N3O — CID 124638933
(Z,1R)-1,3-diamino-3-pyridin-2-ylprop-2-en-1-ol (PubChem CID 124638933) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is (Z,1R)-1,3-diamino-3-pyridin-2-ylprop-2-en-1-ol.
| Compound Name | (Z,1R)-1,3-diamino-3-pyridin-2-ylprop-2-en-1-ol |
|---|---|
| PubChem CID | 124638933 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | (Z,1R)-1,3-diamino-3-pyridin-2-ylprop-2-en-1-ol |
| SMILES | N/C(=C\[C@H](N)O)c1ccccn1 |
| InChI | InChI=1S/C8H11N3O/c9-6(5-8(10)12)7-3-1-2-4-11-7/h1-5,8,12H,9-10H2/b6-5-/t8-/m1/s1 |
| InChIKey | ZVIYJIDKEJDBFD-RPSMYOMKSA-N |
| XLogP | -0.34 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|