C16H24OSi — CID 102522255
(E)-4,4-dimethyl-1-phenyl-1-trimethylsilylpent-1-en-3-one (PubChem CID 102522255) has the molecular formula C16H24OSi and a molecular weight of 260.45 g/mol. Its IUPAC name is (E)-4,4-dimethyl-1-phenyl-1-trimethylsilylpent-1-en-3-one.
| Compound Name | (E)-4,4-dimethyl-1-phenyl-1-trimethylsilylpent-1-en-3-one |
|---|---|
| PubChem CID | 102522255 |
| Molecular Formula | C16H24OSi |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | (E)-4,4-dimethyl-1-phenyl-1-trimethylsilylpent-1-en-3-one |
| SMILES | CC(C)(C)C(=O)/C=C(\c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C16H24OSi/c1-16(2,3)15(17)12-14(18(4,5)6)13-10-8-7-9-11-13/h7-12H,1-6H3/b14-12+ |
| InChIKey | WNDCKWFIJOABRG-WYMLVPIESA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|