C20H22OPd2Si — CID 175858703
1,5-diphenyl-1-trimethylsilylpenta-1,4-dien-3-one;bis(palladium) (PubChem CID 175858703) has the molecular formula C20H22OPd2Si and a molecular weight of 519.32 g/mol. Its IUPAC name is 1,5-diphenyl-1-trimethylsilylpenta-1,4-dien-3-one;bis(palladium).
| Compound Name | 1,5-diphenyl-1-trimethylsilylpenta-1,4-dien-3-one;bis(palladium) |
|---|---|
| PubChem CID | 175858703 |
| Molecular Formula | C20H22OPd2Si |
| Molecular Weight | 519.32 g/mol |
| Exact Mass | 517.95 |
| IUPAC Name | 1,5-diphenyl-1-trimethylsilylpenta-1,4-dien-3-one;bis(palladium) |
| SMILES | C[Si](C)(C)C(=CC(=O)C=Cc1ccccc1)c1ccccc1.[Pd].[Pd] |
| InChI | InChI=1S/C20H22OSi.2Pd/c1-22(2,3)20(18-12-8-5-9-13-18)16-19(21)15-14-17-10-6-4-7-11-17;;/h4-16H,1-3H3;; |
| InChIKey | ZFLYVPJBOIOZDE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|