C21H22O2Si — CID 15339829
(E)-1,4-diphenyl-2-(1-trimethylsilylethenyl)but-2-ene-1,4-dione (PubChem CID 15339829) has the molecular formula C21H22O2Si and a molecular weight of 334.49 g/mol. Its IUPAC name is (E)-1,4-diphenyl-2-(1-trimethylsilylethenyl)but-2-ene-1,4-dione.
| Compound Name | (E)-1,4-diphenyl-2-(1-trimethylsilylethenyl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 15339829 |
| Molecular Formula | C21H22O2Si |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (E)-1,4-diphenyl-2-(1-trimethylsilylethenyl)but-2-ene-1,4-dione |
| SMILES | C=C(/C(=C/C(=O)c1ccccc1)C(=O)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C21H22O2Si/c1-16(24(2,3)4)19(21(23)18-13-9-6-10-14-18)15-20(22)17-11-7-5-8-12-17/h5-15H,1H2,2-4H3/b19-15- |
| InChIKey | HWOBGNMQLVPSDP-CYVLTUHYSA-N |
| XLogP | 5.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|