C11H10O2 — CID 11344281
2-methylidene-1-phenylbutane-1,3-dione (PubChem CID 11344281) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-methylidene-1-phenylbutane-1,3-dione.
| Compound Name | 2-methylidene-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 11344281 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2-methylidene-1-phenylbutane-1,3-dione |
| SMILES | C=C(C(C)=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C11H10O2/c1-8(9(2)12)11(13)10-6-4-3-5-7-10/h3-7H,1H2,2H3 |
| InChIKey | QVAZCOROEAVHOE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|