C29H25IrN4- — CID 59358812
9-(2,6-dimethylphenyl)-2-(3,5-dimethylpyrazol-1-yl)-7-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium (PubChem CID 59358812) has the molecular formula C29H25IrN4- and a molecular weight of 621.76 g/mol. Its IUPAC name is 9-(2,6-dimethylphenyl)-2-(3,5-dimethylpyrazol-1-yl)-7-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium.
| Compound Name | 9-(2,6-dimethylphenyl)-2-(3,5-dimethylpyrazol-1-yl)-7-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
|---|---|
| PubChem CID | 59358812 |
| Molecular Formula | C29H25IrN4- |
| Molecular Weight | 621.76 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | 9-(2,6-dimethylphenyl)-2-(3,5-dimethylpyrazol-1-yl)-7-methyl-12H-imidazo[1,2-f]phenanthridin-12-ide;iridium |
| SMILES | Cc1ccc2c(c1)c1c(-c3c(C)cccc3C)cc[c-]c1c1nc(-n3nc(C)cc3C)cn21.[Ir] |
| InChI | InChI=1S/C29H25N4.Ir/c1-17-12-13-25-24(14-17)28-22(27-18(2)8-6-9-19(27)3)10-7-11-23(28)29-30-26(16-32(25)29)33-21(5)15-20(4)31-33;/h6-10,12-16H,1-5H3;/q-1; |
| InChIKey | FIMBMGWEOOYROW-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.76 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|