C11H12ClN3 — CID 139300479
2-chloro-6-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine (PubChem CID 139300479) has the molecular formula C11H12ClN3 and a molecular weight of 221.69 g/mol. Its IUPAC name is 2-chloro-6-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine.
| Compound Name | 2-chloro-6-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine |
|---|---|
| PubChem CID | 139300479 |
| Molecular Formula | C11H12ClN3 |
| Molecular Weight | 221.69 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-chloro-6-(3,5-dimethylpyrazol-1-yl)-4-methylpyridine |
| SMILES | Cc1cc(Cl)nc(-n2nc(C)cc2C)c1 |
| InChI | InChI=1S/C11H12ClN3/c1-7-4-10(12)13-11(5-7)15-9(3)6-8(2)14-15/h4-6H,1-3H3 |
| InChIKey | VHQZLOKQJAIICC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.69 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|