C9H12N4 — CID 12560600
3,5-dimethyl-1-(5-methyl-1H-pyrazol-3-yl)pyrazole (PubChem CID 12560600) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 3,5-dimethyl-1-(5-methyl-1H-pyrazol-3-yl)pyrazole.
| Compound Name | 3,5-dimethyl-1-(5-methyl-1H-pyrazol-3-yl)pyrazole |
|---|---|
| PubChem CID | 12560600 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 3,5-dimethyl-1-(5-methyl-1H-pyrazol-3-yl)pyrazole |
| SMILES | Cc1cc(C)n(-c2cc(C)[nH]n2)n1 |
| InChI | InChI=1S/C9H12N4/c1-6-5-9(11-10-6)13-8(3)4-7(2)12-13/h4-5H,1-3H3,(H,10,11) |
| InChIKey | JVTUGNXBSAHJHN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |