C15H18N6 — CID 102051125
4,6-bis(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidine (PubChem CID 102051125) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is 4,6-bis(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidine.
| Compound Name | 4,6-bis(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidine |
|---|---|
| PubChem CID | 102051125 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4,6-bis(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidine |
| SMILES | Cc1cc(C)n(-c2cc(-n3nc(C)cc3C)nc(C)n2)n1 |
| InChI | InChI=1S/C15H18N6/c1-9-6-11(3)20(18-9)14-8-15(17-13(5)16-14)21-12(4)7-10(2)19-21/h6-8H,1-5H3 |
| InChIKey | QMFPLUHCFLLTIF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |