C18H15F5N6 — CID 5332806
6-(3,5-dimethylpyrazol-1-yl)-2-methyl-N-[(E)-1-(2,3,4,5,6-pentafluorophenyl)ethylideneamino]pyrimidin-4-amine (PubChem CID 5332806) has the molecular formula C18H15F5N6 and a molecular weight of 410.35 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)-2-methyl-N-[(E)-1-(2,3,4,5,6-pentafluorophenyl)ethylideneamino]pyrimidin-4-amine.
| Compound Name | 6-(3,5-dimethylpyrazol-1-yl)-2-methyl-N-[(E)-1-(2,3,4,5,6-pentafluorophenyl)ethylideneamino]pyrimidin-4-amine |
|---|---|
| PubChem CID | 5332806 |
| Molecular Formula | C18H15F5N6 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 6-(3,5-dimethylpyrazol-1-yl)-2-methyl-N-[(E)-1-(2,3,4,5,6-pentafluorophenyl)ethylideneamino]pyrimidin-4-amine |
| SMILES | C/C(=N\Nc1cc(-n2nc(C)cc2C)nc(C)n1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H15F5N6/c1-7-5-8(2)29(28-7)12-6-11(24-10(4)25-12)27-26-9(3)13-14(19)16(21)18(23)17(22)15(13)20/h5-6H,1-4H3,(H,24,25,27)/b26-9+ |
| InChIKey | PJVMJPSXVKBSSV-JQAMDZJQSA-N |
| XLogP | 4.12 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|