C21H21F3N6O — CID 122338036
[4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 122338036) has the molecular formula C21H21F3N6O and a molecular weight of 430.43 g/mol. Its IUPAC name is [4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 122338036 |
| Molecular Formula | C21H21F3N6O |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [4-[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | Cc1cc(C)n(-c2cc(N3CCN(C(=O)c4ccc(F)c(F)c4F)CC3)nc(C)n2)n1 |
| InChI | InChI=1S/C21H21F3N6O/c1-12-10-13(2)30(27-12)18-11-17(25-14(3)26-18)28-6-8-29(9-7-28)21(31)15-4-5-16(22)20(24)19(15)23/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | SOHCSEGFMXEDHC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|