C19H17F3N6O — CID 122338546
[4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 122338546) has the molecular formula C19H17F3N6O and a molecular weight of 402.38 g/mol. Its IUPAC name is [4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 122338546 |
| Molecular Formula | C19H17F3N6O |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [4-(6-imidazol-1-yl-2-methylpyrimidin-4-yl)piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | Cc1nc(N2CCN(C(=O)c3ccc(F)c(F)c3F)CC2)cc(-n2ccnc2)n1 |
| InChI | InChI=1S/C19H17F3N6O/c1-12-24-15(10-16(25-12)28-5-4-23-11-28)26-6-8-27(9-7-26)19(29)13-2-3-14(20)18(22)17(13)21/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | NQLRZCLRDXSSHG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|