C19H20ClFN6O — CID 70703873
2-chloro-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-6-fluorobenzamide (PubChem CID 70703873) has the molecular formula C19H20ClFN6O and a molecular weight of 402.86 g/mol. Its IUPAC name is 2-chloro-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 70703873 |
| Molecular Formula | C19H20ClFN6O |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 2-chloro-N-[2-[[6-(3,5-dimethylpyrazol-1-yl)-2-methylpyrimidin-4-yl]amino]ethyl]-6-fluorobenzamide |
| SMILES | Cc1cc(C)n(-c2cc(NCCNC(=O)c3c(F)cccc3Cl)nc(C)n2)n1 |
| InChI | InChI=1S/C19H20ClFN6O/c1-11-9-12(2)27(26-11)17-10-16(24-13(3)25-17)22-7-8-23-19(28)18-14(20)5-4-6-15(18)21/h4-6,9-10H,7-8H2,1-3H3,(H,23,28)(H,22,24,25) |
| InChIKey | FXUABAWULOUCHD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|