C12H14N4S — CID 114768027
2-(3,5-dimethylpyrazol-1-yl)-6-methylpyridine-4-carbothioamide (PubChem CID 114768027) has the molecular formula C12H14N4S and a molecular weight of 246.34 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-6-methylpyridine-4-carbothioamide.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-6-methylpyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114768027 |
| Molecular Formula | C12H14N4S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-6-methylpyridine-4-carbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(-n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C12H14N4S/c1-7-5-10(12(13)17)6-11(14-7)16-9(3)4-8(2)15-16/h4-6H,1-3H3,(H2,13,17) |
| InChIKey | OHCCBXMNLHKJDP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|