C11H13N5 — CID 24691587
2-(3,5-dimethylpyrazol-1-yl)pyridine-4-carboximidamide (PubChem CID 24691587) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)pyridine-4-carboximidamide.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 24691587 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(-n2nc(C)cc2C)c1 |
| InChI | InChI=1S/C11H13N5/c1-7-5-8(2)16(15-7)10-6-9(11(12)13)3-4-14-10/h3-6H,1-2H3,(H3,12,13) |
| InChIKey | XOZGDAYSXBUSIA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|