C13H17N5 — CID 61236499
2-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridine-4-carboximidamide (PubChem CID 61236499) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridine-4-carboximidamide.
| Compound Name | 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 61236499 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(-n2nc(C)c(CC)c2C)c1 |
| InChI | InChI=1S/C13H17N5/c1-4-11-8(2)17-18(9(11)3)12-7-10(13(14)15)5-6-16-12/h5-7H,4H2,1-3H3,(H3,14,15) |
| InChIKey | HAKAXNIAENMDDM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|