C16H22N4 — CID 114483656
4-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-3-methylbenzenecarboximidamide (PubChem CID 114483656) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 4-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-3-methylbenzenecarboximidamide.
| Compound Name | 4-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 114483656 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]-3-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cn2nc(C)c(CC)c2C)c(C)c1 |
| InChI | InChI=1S/C16H22N4/c1-5-15-11(3)19-20(12(15)4)9-14-7-6-13(16(17)18)8-10(14)2/h6-8H,5,9H2,1-4H3,(H3,17,18) |
| InChIKey | JYGKUEJJXCUGAS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|