C14H17FN4 — CID 61226960
3-fluoro-4-[(3,4,5-trimethylpyrazol-1-yl)methyl]benzenecarboximidamide (PubChem CID 61226960) has the molecular formula C14H17FN4 and a molecular weight of 260.32 g/mol. Its IUPAC name is 3-fluoro-4-[(3,4,5-trimethylpyrazol-1-yl)methyl]benzenecarboximidamide.
| Compound Name | 3-fluoro-4-[(3,4,5-trimethylpyrazol-1-yl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 61226960 |
| Molecular Formula | C14H17FN4 |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3-fluoro-4-[(3,4,5-trimethylpyrazol-1-yl)methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cn2nc(C)c(C)c2C)c(F)c1 |
| InChI | InChI=1S/C14H17FN4/c1-8-9(2)18-19(10(8)3)7-12-5-4-11(14(16)17)6-13(12)15/h4-6H,7H2,1-3H3,(H3,16,17) |
| InChIKey | DYIHBCTYIZQAGC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|