C16H22N4O — CID 61299238
4-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethoxy]benzenecarboximidamide (PubChem CID 61299238) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethoxy]benzenecarboximidamide.
| Compound Name | 4-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 61299238 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 4-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCn2nc(C)c(CC)c2C)cc1 |
| InChI | InChI=1S/C16H22N4O/c1-4-15-11(2)19-20(12(15)3)9-10-21-14-7-5-13(6-8-14)16(17)18/h5-8H,4,9-10H2,1-3H3,(H3,17,18) |
| InChIKey | TWPUZAIQTFKFHJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|