C11H15Cl2N5 — CID 47002494
6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboximidamide;dihydrochloride (PubChem CID 47002494) has the molecular formula C11H15Cl2N5 and a molecular weight of 288.18 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboximidamide;dihydrochloride.
| Compound Name | 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 47002494 |
| Molecular Formula | C11H15Cl2N5 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(-n2nc(C)cc2C)nc1 |
| InChI | InChI=1S/C11H13N5.2ClH/c1-7-5-8(2)16(15-7)10-4-3-9(6-14-10)11(12)13;;/h3-6H,1-2H3,(H3,12,13);2*1H |
| InChIKey | OEZRLTFNNUKHNB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|