C5H9N2Na — CID 174789543
sodium;3,5-dimethyl-1H-pyrazole;hydride (PubChem CID 174789543) has the molecular formula C5H9N2Na and a molecular weight of 120.13 g/mol. Its IUPAC name is sodium;3,5-dimethyl-1H-pyrazole;hydride.
| Compound Name | sodium;3,5-dimethyl-1H-pyrazole;hydride |
|---|---|
| PubChem CID | 174789543 |
| Molecular Formula | C5H9N2Na |
| Molecular Weight | 120.13 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | sodium;3,5-dimethyl-1H-pyrazole;hydride |
| SMILES | Cc1cc(C)[nH]n1.[H-].[Na+] |
| InChI | InChI=1S/C5H8N2.Na.H/c1-4-3-5(2)7-6-4;;/h3H,1-2H3,(H,6,7);;/q;+1;-1 |
| InChIKey | WJTNOEPDVKVNKN-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.13 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |