C11H20N2O — CID 143661078
3,3-dimethylbutan-2-one;3,5-dimethyl-1H-pyrazole (PubChem CID 143661078) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-one;3,5-dimethyl-1H-pyrazole.
| Compound Name | 3,3-dimethylbutan-2-one;3,5-dimethyl-1H-pyrazole |
|---|---|
| PubChem CID | 143661078 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3,3-dimethylbutan-2-one;3,5-dimethyl-1H-pyrazole |
| SMILES | CC(=O)C(C)(C)C.Cc1cc(C)[nH]n1 |
| InChI | InChI=1S/C6H12O.C5H8N2/c1-5(7)6(2,3)4;1-4-3-5(2)7-6-4/h1-4H3;3H,1-2H3,(H,6,7) |
| InChIKey | HBGJLBIVOLYODT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |