C7H14N2O — CID 175303742
3,5-dimethyl-1H-pyrazole;ethanol (PubChem CID 175303742) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 3,5-dimethyl-1H-pyrazole;ethanol.
| Compound Name | 3,5-dimethyl-1H-pyrazole;ethanol |
|---|---|
| PubChem CID | 175303742 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 3,5-dimethyl-1H-pyrazole;ethanol |
| SMILES | CCO.Cc1cc(C)[nH]n1 |
| InChI | InChI=1S/C5H8N2.C2H6O/c1-4-3-5(2)7-6-4;1-2-3/h3H,1-2H3,(H,6,7);3H,2H2,1H3 |
| InChIKey | SQKVUEJHPIKNQS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |