C6H10N2S2 — CID 175518548
3,5-dimethyl-1H-pyrazole;methanedithioic acid (PubChem CID 175518548) has the molecular formula C6H10N2S2 and a molecular weight of 174.29 g/mol. Its IUPAC name is 3,5-dimethyl-1H-pyrazole;methanedithioic acid.
| Compound Name | 3,5-dimethyl-1H-pyrazole;methanedithioic acid |
|---|---|
| PubChem CID | 175518548 |
| Molecular Formula | C6H10N2S2 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 3,5-dimethyl-1H-pyrazole;methanedithioic acid |
| SMILES | Cc1cc(C)[nH]n1.S=CS |
| InChI | InChI=1S/C5H8N2.CH2S2/c1-4-3-5(2)7-6-4;2-1-3/h3H,1-2H3,(H,6,7);1H,(H,2,3) |
| InChIKey | AQUQSIKBAZAQLH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|