About 3,5-dimethyl-1H-pyrazole;pyridine
3,5-dimethyl-1H-pyrazole;pyridine (PubChem CID 174790538) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 3,5-dimethyl-1H-pyrazole;pyridine.
Molecular Properties
| Compound Name | 3,5-dimethyl-1H-pyrazole;pyridine |
| PubChem CID | 174790538 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 3,5-dimethyl-1H-pyrazole;pyridine |
| SMILES | Cc1cc(C)[nH]n1.c1ccncc1 |
| InChI | InChI=1S/C5H8N2.C5H5N/c1-4-3-5(2)7-6-4;1-2-4-6-5-3-1/h3H,1-2H3,(H,6,7);1-5H |
| InChIKey | QKYHRWDHDOXKKY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-1H-pyrazole;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1H-pyrazole;pyridine?
The IUPAC name of 3,5-dimethyl-1H-pyrazole;pyridine (CID 174790538) is 3,5-dimethyl-1H-pyrazole;pyridine.
What is the SMILES notation for 3,5-dimethyl-1H-pyrazole;pyridine?
The canonical SMILES for 3,5-dimethyl-1H-pyrazole;pyridine is Cc1cc(C)[nH]n1.c1ccncc1.
What is the InChIKey of 3,5-dimethyl-1H-pyrazole;pyridine?
The InChIKey is QKYHRWDHDOXKKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.C5H5N/c1-4-3-5(2)7-6-4;1-2-4-6-5-3-1/h3H,1-2H3,(H,6,7);1-5H.
What are the key properties of 3,5-dimethyl-1H-pyrazole;pyridine?
3,5-dimethyl-1H-pyrazole;pyridine has a molecular weight of 175.23 g/mol, XLogP of 2.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1H-pyrazole;pyridine is sourced from PubChem (CID 174790538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).