C9H19N3 — CID 171515765
ethane;N-[(5-methyl-1H-pyrazol-3-yl)methyl]ethanamine (PubChem CID 171515765) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is ethane;N-[(5-methyl-1H-pyrazol-3-yl)methyl]ethanamine.
| Compound Name | ethane;N-[(5-methyl-1H-pyrazol-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 171515765 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | ethane;N-[(5-methyl-1H-pyrazol-3-yl)methyl]ethanamine |
| SMILES | CC.CCNCc1cc(C)[nH]n1 |
| InChI | InChI=1S/C7H13N3.C2H6/c1-3-8-5-7-4-6(2)9-10-7;1-2/h4,8H,3,5H2,1-2H3,(H,9,10);1-2H3 |
| InChIKey | MZZNEYYLHMWFNC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |