C9H15N3S — CID 134111599
2,2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)propanethioamide (PubChem CID 134111599) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 2,2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)propanethioamide.
| Compound Name | 2,2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)propanethioamide |
|---|---|
| PubChem CID | 134111599 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2,2-dimethyl-N-(5-methyl-1H-pyrazol-3-yl)propanethioamide |
| SMILES | Cc1cc(NC(=S)C(C)(C)C)n[nH]1 |
| InChI | InChI=1S/C9H15N3S/c1-6-5-7(12-11-6)10-8(13)9(2,3)4/h5H,1-4H3,(H2,10,11,12,13) |
| InChIKey | GZBHHHPCTWAXJI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|