C15H21ClN4 — CID 139300724
2-chloro-N-(2,2-dimethylpropyl)-6-(3,5-dimethylpyrazol-1-yl)pyridin-4-amine (PubChem CID 139300724) has the molecular formula C15H21ClN4 and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethylpropyl)-6-(3,5-dimethylpyrazol-1-yl)pyridin-4-amine.
| Compound Name | 2-chloro-N-(2,2-dimethylpropyl)-6-(3,5-dimethylpyrazol-1-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 139300724 |
| Molecular Formula | C15H21ClN4 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-chloro-N-(2,2-dimethylpropyl)-6-(3,5-dimethylpyrazol-1-yl)pyridin-4-amine |
| SMILES | Cc1cc(C)n(-c2cc(NCC(C)(C)C)cc(Cl)n2)n1 |
| InChI | InChI=1S/C15H21ClN4/c1-10-6-11(2)20(19-10)14-8-12(7-13(16)18-14)17-9-15(3,4)5/h6-8H,9H2,1-5H3,(H,17,18) |
| InChIKey | VIFXLLRFBUPFMF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|