C27H25IrN2- — CID 59359178
iridium;2,5,6-trimethyl-8-(2,4,6-trimethylphenyl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide (PubChem CID 59359178) has the molecular formula C27H25IrN2- and a molecular weight of 569.73 g/mol. Its IUPAC name is iridium;2,5,6-trimethyl-8-(2,4,6-trimethylphenyl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide.
| Compound Name | iridium;2,5,6-trimethyl-8-(2,4,6-trimethylphenyl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide |
|---|---|
| PubChem CID | 59359178 |
| Molecular Formula | C27H25IrN2- |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | iridium;2,5,6-trimethyl-8-(2,4,6-trimethylphenyl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide |
| SMILES | Cc1cc(C)c(-c2cc[c-]c3c2c2cc(C)c(C)cc2c2cc(C)nn32)c(C)c1.[Ir] |
| InChI | InChI=1S/C27H25N2.Ir/c1-15-10-18(4)26(19(5)11-15)21-8-7-9-24-27(21)23-13-17(3)16(2)12-22(23)25-14-20(6)28-29(24)25;/h7-8,10-14H,1-6H3;/q-1; |
| InChIKey | BVWNBZORITWGDI-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|