C21H13IrN2- — CID 59359036
iridium;8-phenyl-11H-pyrazolo[1,5-f]phenanthridin-11-ide (PubChem CID 59359036) has the molecular formula C21H13IrN2- and a molecular weight of 485.57 g/mol. Its IUPAC name is iridium;8-phenyl-11H-pyrazolo[1,5-f]phenanthridin-11-ide.
| Compound Name | iridium;8-phenyl-11H-pyrazolo[1,5-f]phenanthridin-11-ide |
|---|---|
| PubChem CID | 59359036 |
| Molecular Formula | C21H13IrN2- |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | iridium;8-phenyl-11H-pyrazolo[1,5-f]phenanthridin-11-ide |
| SMILES | [Ir].[c-]1ccc(-c2ccccc2)c2c3ccccc3c3ccnn3c12 |
| InChI | InChI=1S/C21H13N2.Ir/c1-2-7-15(8-3-1)16-11-6-12-20-21(16)18-10-5-4-9-17(18)19-13-14-22-23(19)20;/h1-11,13-14H;/q-1; |
| InChIKey | GXRUZSKRICTERB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|