C29H20IrN3- — CID 59358758
9-(9-ethylcarbazol-3-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium (PubChem CID 59358758) has the molecular formula C29H20IrN3- and a molecular weight of 602.72 g/mol. Its IUPAC name is 9-(9-ethylcarbazol-3-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium.
| Compound Name | 9-(9-ethylcarbazol-3-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium |
|---|---|
| PubChem CID | 59358758 |
| Molecular Formula | C29H20IrN3- |
| Molecular Weight | 602.72 g/mol |
| Exact Mass | 603.13 |
| IUPAC Name | 9-(9-ethylcarbazol-3-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium |
| SMILES | CCn1c2ccccc2c2cc(-c3c[c-]c4c(c3)c3ccccc3c3ccnn43)ccc21.[Ir] |
| InChI | InChI=1S/C29H20N3.Ir/c1-2-31-26-10-6-5-9-23(26)25-18-19(11-13-27(25)31)20-12-14-28-24(17-20)21-7-3-4-8-22(21)29-15-16-30-32(28)29;/h3-13,15-18H,2H2,1H3;/q-1; |
| InChIKey | FFEXXLGIOGGPRV-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.72 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|