C29H17N7 — CID 118205034
18-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,6,7,18-tetrazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene (PubChem CID 118205034) has the molecular formula C29H17N7 and a molecular weight of 463.50 g/mol. Its IUPAC name is 18-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,6,7,18-tetrazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene.
| Compound Name | 18-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,6,7,18-tetrazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene |
|---|---|
| PubChem CID | 118205034 |
| Molecular Formula | C29H17N7 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 18-(4,6-diphenyl-1,3,5-triazin-2-yl)-3,6,7,18-tetrazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4cccc5c4c4c3cncc4n3nccc53)n2)cc1 |
| InChI | InChI=1S/C29H17N7/c1-3-8-18(9-4-1)27-32-28(19-10-5-2-6-11-19)34-29(33-27)35-22-13-7-12-20-21-14-15-31-36(21)24-17-30-16-23(35)26(24)25(20)22/h1-17H |
| InChIKey | BCMPNNBZDYTJSC-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 73.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|