C36H22N6 — CID 118205032
18-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-3,6,7,18-tetrazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene (PubChem CID 118205032) has the molecular formula C36H22N6 and a molecular weight of 538.61 g/mol. Its IUPAC name is 18-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-3,6,7,18-tetrazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene.
| Compound Name | 18-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-3,6,7,18-tetrazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene |
|---|---|
| PubChem CID | 118205032 |
| Molecular Formula | C36H22N6 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 18-[4-(2,6-diphenylpyrimidin-4-yl)phenyl]-3,6,7,18-tetrazapentacyclo[13.2.1.05,17.06,10.011,16]octadeca-1,3,5(17),7,9,11(16),12,14-octaene |
| SMILES | c1ccc(-c2cc(-c3ccc(-n4c5cccc6c5c5c4cncc5n4nccc64)cc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C36H22N6/c1-3-8-23(9-4-1)28-20-29(40-36(39-28)25-10-5-2-6-11-25)24-14-16-26(17-15-24)41-31-13-7-12-27-30-18-19-38-42(30)33-22-37-21-32(41)35(33)34(27)31/h1-22H |
| InChIKey | HLOJTLHXVBZFSX-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|