C27H23N3 — CID 59358296
4,6-dimethyl-8-(2,4,6-trimethylphenyl)pyrazolo[1,5-f]phenanthridine-2-carbonitrile (PubChem CID 59358296) has the molecular formula C27H23N3 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4,6-dimethyl-8-(2,4,6-trimethylphenyl)pyrazolo[1,5-f]phenanthridine-2-carbonitrile.
| Compound Name | 4,6-dimethyl-8-(2,4,6-trimethylphenyl)pyrazolo[1,5-f]phenanthridine-2-carbonitrile |
|---|---|
| PubChem CID | 59358296 |
| Molecular Formula | C27H23N3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 4,6-dimethyl-8-(2,4,6-trimethylphenyl)pyrazolo[1,5-f]phenanthridine-2-carbonitrile |
| SMILES | Cc1cc(C)c(-c2cccc3c2c2cc(C)cc(C)c2c2cc(C#N)nn23)c(C)c1 |
| InChI | InChI=1S/C27H23N3/c1-15-9-17(3)25(18(4)10-15)21-7-6-8-23-27(21)22-12-16(2)11-19(5)26(22)24-13-20(14-28)29-30(23)24/h6-13H,1-5H3 |
| InChIKey | RIXNAXWQRREOMI-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|