C19H16 — CID 123365780
3,7,9-trimethylfluoranthene (PubChem CID 123365780) has the molecular formula C19H16 and a molecular weight of 244.34 g/mol. Its IUPAC name is 3,7,9-trimethylfluoranthene.
| Compound Name | 3,7,9-trimethylfluoranthene |
|---|---|
| PubChem CID | 123365780 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3,7,9-trimethylfluoranthene |
| SMILES | Cc1cc(C)c2c(c1)-c1ccc(C)c3cccc-2c13 |
| InChI | InChI=1S/C19H16/c1-11-9-13(3)18-16-6-4-5-14-12(2)7-8-15(19(14)16)17(18)10-11/h4-10H,1-3H3 |
| InChIKey | YOLBSPMIPDAGTQ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |