C36H28O2 — CID 71142914
7,12-bis(4-methoxyphenyl)-3,9-dimethylbenzo[k]fluoranthene (PubChem CID 71142914) has the molecular formula C36H28O2 and a molecular weight of 492.62 g/mol. Its IUPAC name is 7,12-bis(4-methoxyphenyl)-3,9-dimethylbenzo[k]fluoranthene.
| Compound Name | 7,12-bis(4-methoxyphenyl)-3,9-dimethylbenzo[k]fluoranthene |
|---|---|
| PubChem CID | 71142914 |
| Molecular Formula | C36H28O2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 7,12-bis(4-methoxyphenyl)-3,9-dimethylbenzo[k]fluoranthene |
| SMILES | COc1ccc(-c2c3c(c(-c4ccc(OC)cc4)c4cc(C)ccc24)-c2cccc4c(C)ccc-3c24)cc1 |
| InChI | InChI=1S/C36H28O2/c1-21-8-18-28-31(20-21)33(24-12-16-26(38-4)17-13-24)35-29-7-5-6-27-22(2)9-19-30(34(27)29)36(35)32(28)23-10-14-25(37-3)15-11-23/h5-20H,1-4H3 |
| InChIKey | HFSRMOHDIPVZSD-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |