C31H28IrN3- — CID 59359304
iridium;6-(2,4,6-trimethylphenyl)-8-(1,2,5-trimethylpyrrol-3-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide (PubChem CID 59359304) has the molecular formula C31H28IrN3- and a molecular weight of 634.80 g/mol. Its IUPAC name is iridium;6-(2,4,6-trimethylphenyl)-8-(1,2,5-trimethylpyrrol-3-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide.
| Compound Name | iridium;6-(2,4,6-trimethylphenyl)-8-(1,2,5-trimethylpyrrol-3-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide |
|---|---|
| PubChem CID | 59359304 |
| Molecular Formula | C31H28IrN3- |
| Molecular Weight | 634.80 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | iridium;6-(2,4,6-trimethylphenyl)-8-(1,2,5-trimethylpyrrol-3-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2c(-c4cc(C)n(C)c4C)cc[c-]c2n2nccc32)c(C)c1.[Ir] |
| InChI | InChI=1S/C31H28N3.Ir/c1-18-14-19(2)30(20(3)15-18)23-10-11-24-27(17-23)31-25(26-16-21(4)33(6)22(26)5)8-7-9-29(31)34-28(24)12-13-32-34;/h7-8,10-17H,1-6H3;/q-1; |
| InChIKey | CRIGGGZWLLAQHV-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.80 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|