C32H27IrN2- — CID 59358903
8-(2,4-dimethylphenyl)-6-(2,6-dimethylphenyl)-2-methyl-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium (PubChem CID 59358903) has the molecular formula C32H27IrN2- and a molecular weight of 631.80 g/mol. Its IUPAC name is 8-(2,4-dimethylphenyl)-6-(2,6-dimethylphenyl)-2-methyl-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium.
| Compound Name | 8-(2,4-dimethylphenyl)-6-(2,6-dimethylphenyl)-2-methyl-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium |
|---|---|
| PubChem CID | 59358903 |
| Molecular Formula | C32H27IrN2- |
| Molecular Weight | 631.80 g/mol |
| Exact Mass | 632.18 |
| IUPAC Name | 8-(2,4-dimethylphenyl)-6-(2,6-dimethylphenyl)-2-methyl-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium |
| SMILES | Cc1ccc(-c2cc[c-]c3c2c2cc(-c4c(C)cccc4C)ccc2c2cc(C)nn32)c(C)c1.[Ir] |
| InChI | InChI=1S/C32H27N2.Ir/c1-19-12-14-25(22(4)16-19)27-10-7-11-29-32(27)28-18-24(31-20(2)8-6-9-21(31)3)13-15-26(28)30-17-23(5)33-34(29)30;/h6-10,12-18H,1-5H3;/q-1; |
| InChIKey | AYXNFVKUJWEMCO-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.80 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|