C48H40N6 — CID 163481587
3-(2,4-dimethylphenyl)-7-[3-(2,4-dimethylphenyl)-10,12-dimethyl-[1,2,4]triazolo[4,3-f]phenanthridin-7-yl]-10,12-dimethyl-[1,2,4]triazolo[4,3-f]phenanthridine (PubChem CID 163481587) has the molecular formula C48H40N6 and a molecular weight of 700.89 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-7-[3-(2,4-dimethylphenyl)-10,12-dimethyl-[1,2,4]triazolo[4,3-f]phenanthridin-7-yl]-10,12-dimethyl-[1,2,4]triazolo[4,3-f]phenanthridine.
| Compound Name | 3-(2,4-dimethylphenyl)-7-[3-(2,4-dimethylphenyl)-10,12-dimethyl-[1,2,4]triazolo[4,3-f]phenanthridin-7-yl]-10,12-dimethyl-[1,2,4]triazolo[4,3-f]phenanthridine |
|---|---|
| PubChem CID | 163481587 |
| Molecular Formula | C48H40N6 |
| Molecular Weight | 700.89 g/mol |
| Exact Mass | 700.33 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-7-[3-(2,4-dimethylphenyl)-10,12-dimethyl-[1,2,4]triazolo[4,3-f]phenanthridin-7-yl]-10,12-dimethyl-[1,2,4]triazolo[4,3-f]phenanthridine |
| SMILES | Cc1ccc(-c2nnc3c4c(C)cc(C)cc4c4cc(-c5ccc6c(c5)c5cc(C)cc(C)c5c5nnc(-c7ccc(C)cc7C)n65)ccc4n23)c(C)c1 |
| InChI | InChI=1S/C48H40N6/c1-25-9-13-35(29(5)17-25)45-49-51-47-43-31(7)19-27(3)21-39(43)37-23-33(11-15-41(37)53(45)47)34-12-16-42-38(24-34)40-22-28(4)20-32(8)44(40)48-52-50-46(54(42)48)36-14-10-26(2)18-30(36)6/h9-24H,1-8H3 |
| InChIKey | CEZWPQGBADPSQG-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.89 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|