C36H32N2 — CID 122492165
6-[3-(6,9-dimethylcarbazol-3-yl)-5-methylphenyl]-1,3,9-trimethylcarbazole (PubChem CID 122492165) has the molecular formula C36H32N2 and a molecular weight of 492.67 g/mol. Its IUPAC name is 6-[3-(6,9-dimethylcarbazol-3-yl)-5-methylphenyl]-1,3,9-trimethylcarbazole.
| Compound Name | 6-[3-(6,9-dimethylcarbazol-3-yl)-5-methylphenyl]-1,3,9-trimethylcarbazole |
|---|---|
| PubChem CID | 122492165 |
| Molecular Formula | C36H32N2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | 6-[3-(6,9-dimethylcarbazol-3-yl)-5-methylphenyl]-1,3,9-trimethylcarbazole |
| SMILES | Cc1cc(-c2ccc3c(c2)c2cc(C)ccc2n3C)cc(-c2ccc3c(c2)c2cc(C)cc(C)c2n3C)c1 |
| InChI | InChI=1S/C36H32N2/c1-21-7-10-33-29(16-21)30-19-25(8-11-34(30)37(33)5)27-14-23(3)15-28(18-27)26-9-12-35-31(20-26)32-17-22(2)13-24(4)36(32)38(35)6/h7-20H,1-6H3 |
| InChIKey | FHYUHNIAEQBNGN-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |