C31H23F3N2O2 — CID 138622461
2,4,5,12-tetramethyl-9-[2-(trifluoromethyl)phenyl]quinolino[2,3-b]acridine-7,14-dione (PubChem CID 138622461) has the molecular formula C31H23F3N2O2 and a molecular weight of 512.53 g/mol. Its IUPAC name is 2,4,5,12-tetramethyl-9-[2-(trifluoromethyl)phenyl]quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 2,4,5,12-tetramethyl-9-[2-(trifluoromethyl)phenyl]quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 138622461 |
| Molecular Formula | C31H23F3N2O2 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 2,4,5,12-tetramethyl-9-[2-(trifluoromethyl)phenyl]quinolino[2,3-b]acridine-7,14-dione |
| SMILES | Cc1cc(C)c2c(c1)c(=O)c1cc3c(cc1n2C)c(=O)c1cc(-c2ccccc2C(F)(F)F)ccc1n3C |
| InChI | InChI=1S/C31H23F3N2O2/c1-16-11-17(2)28-23(12-16)30(38)22-14-26-21(15-27(22)36(28)4)29(37)20-13-18(9-10-25(20)35(26)3)19-7-5-6-8-24(19)31(32,33)34/h5-15H,1-4H3 |
| InChIKey | XQBKQDSBIZXVSD-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|