C34H22Cl2N2O2 — CID 138622627
2,9-bis(2-chlorophenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione (PubChem CID 138622627) has the molecular formula C34H22Cl2N2O2 and a molecular weight of 561.47 g/mol. Its IUPAC name is 2,9-bis(2-chlorophenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 2,9-bis(2-chlorophenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 138622627 |
| Molecular Formula | C34H22Cl2N2O2 |
| Molecular Weight | 561.47 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 2,9-bis(2-chlorophenyl)-5,12-dimethylquinolino[2,3-b]acridine-7,14-dione |
| SMILES | Cn1c2ccc(-c3ccccc3Cl)cc2c(=O)c2cc3c(cc21)c(=O)c1cc(-c2ccccc2Cl)ccc1n3C |
| InChI | InChI=1S/C34H22Cl2N2O2/c1-37-29-13-11-19(21-7-3-5-9-27(21)35)15-23(29)33(39)25-18-32-26(17-31(25)37)34(40)24-16-20(12-14-30(24)38(32)2)22-8-4-6-10-28(22)36/h3-18H,1-2H3 |
| InChIKey | UYCLGNDUAZDJGY-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.47 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|